نام محصول |
2-Bromobenzaldehyde oxime |
مترادف |
2-Bromobenzaldoxime |
میدان مغناطیسی |
C7H6BrNO |
وزن مولکولی |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c8-7-4-2-1-3-6(7)5-9-10/h1-5,10H/b9-5+ |
شماره سیایاس |
34158-72-0 |
ساختار مولکولی |
|
تراکم |
1.52g/cm3 |
نقطه ذوب |
102-104℃ |
نقطه غلیان |
265.6°C at 760 mmHg |
ضریب شکست |
1.581 |
نقطه اشتعال |
114.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|