Ονομασία του προϊόντος |
3,5-Dibromo-4-methylpyridine |
Συνώνυμα |
3,5-Dibromo-4-picoline |
MF |
C6H5Br2N |
Μοριακό βάρος |
250.9186 |
InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
CAS ΟΧΙ |
3430-23-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.911g/cm3 |
Σημείο βρασμού |
243°C at 760 mmHg |
Δείκτης διάθλασης |
1.593 |
Σημείο ανάφλεξης |
100.7°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|