نام محصول |
2-Phenylethyl-1-boronic acid |
مترادف |
Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
میدان مغناطیسی |
C8H9BO2 |
وزن مولکولی |
147.9669 |
InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
شماره سیایاس |
34420-17-2 |
ساختار مولکولی |
|
تراکم |
1.13g/cm3 |
نقطه غلیان |
315.9°C at 760 mmHg |
ضریب شکست |
1.587 |
نقطه اشتعال |
144.9°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|