שם המוצר |
N,N-Bis(2-cyanoethyl)formamide |
נרדפות |
3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
מולקולרית פורמולה |
C7H9N3O |
משקל מולקולרי |
151.1659 |
InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
מספר CAS |
3445-84-9 |
EINECS |
222-362-0 |
מבנה מולקולרי |
|
צפיפות |
1.116g/cm3 |
נקודת רתיחה |
444.1°C at 760 mmHg |
משקל סגולי |
1.476 |
נקודת הבזק |
222.4°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|