product Name |
Phenyl nicotinate |
Synonyms |
Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
Molecular Formula |
C12H9NO2 |
Molecular Weight |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
CAS Registry Number |
3468-53-9 |
EINECS |
222-428-9 |
Molecular Structure |
|
Density |
1.199g/cm3 |
Melting point |
70-72℃ |
Boiling point |
338.9°C at 760 mmHg |
Refractive index |
1.589 |
Flash point |
158.8°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|