Produkt-Name |
1-Naphthaleneacethydrazide |
Synonyme |
AKOS BBB/161; AKOS AU36-M591; 2-NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-NAPHTHYL)ACETOHYDRAZIDE; ASISCHEM D13399; NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-Naphthyl)acethydrazide; 2-(naphthalen-1-yl)acetohydrazide |
Molekulare Formel |
C12H12N2O |
Molecular Weight |
200.2365 |
InChI |
InChI=1/C12H12N2O/c13-14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,13H2,(H,14,15) |
CAS Registry Number |
34800-90-3 |
Molecular Structure |
|
Dichte |
1.206g/cm3 |
Siedepunkt |
466.4°C at 760 mmHg |
Brechungsindex |
1.653 |
Flammpunkt |
235.9°C |
Gefahrensymbole |
Xi:;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|