název výrobku |
Benzhydryl isothiocyanate |
Synonyma |
Diphenylmethyl isothiocyanate; 1,1'-(isothiocyanatomethanediyl)dibenzene |
Molekulární vzorec |
C14H11NS |
Molekulová hmotnost |
225.3088 |
InChI |
InChI=1/C14H11NS/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
Registrační číslo CAS |
3550-21-8 |
Molekulární struktura |
|
Hustota |
1.05g/cm3 |
Bod tání |
58℃ |
Bod varu |
333.3°C at 760 mmHg |
Index lomu |
1.59 |
Bod vzplanutí |
163°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|