Produkt-Name |
cis-3-hexenyl acetate |
Synonyme |
Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate |
Molekulare Formel |
C8H14O2 |
Molecular Weight |
142.2 |
InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
CAS Registry Number |
3681-71-8 |
EINECS |
222-960-1 |
Molecular Structure |
|
Dichte |
0.897 |
Siedepunkt |
75-76℃ (23 mmHg) |
Brechungsindex |
1.427 |
Flammpunkt |
135�H |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|