نام محصول |
N-(2-Methoxyphenyl)maleamic acid |
مترادف |
(2Z)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoic acid; (2E)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoate |
میدان مغناطیسی |
C11H10NO4 |
وزن مولکولی |
220.2019 |
InChI |
InChI=1/C11H11NO4/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/p-1/b7-6+ |
شماره سیایاس |
36847-94-6 |
ساختار مولکولی |
|
نقطه غلیان |
468.9°C at 760 mmHg |
نقطه اشتعال |
237.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|