Nama produk |
2-Nonenoic acid |
Sinonim |
trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
MF |
C9H16O2 |
Berat Molekul |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
CAS NO |
3760-11-0 |
EINECS |
223-171-5 |
Struktur Molekul |
|
Kepadatan |
0.944g/cm3 |
Titik didih |
261.5°C at 760 mmHg |
Indeks bias |
1.46 |
Titik nyala |
168.3°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|