Nome del prodotto |
(R*,S*)-3-Mercaptobutan-2-ol |
Sinonimi |
2-Butanol, 3-mercapto-,(2R,3S)-rel-; 2-Butanol,3-mercapto-, (R*,S*)-; 3-Mercapto-2-butanol; 2-Butanol, 3-mercapto-, (theta,S)-; 2-Mercapto-3-Butanol; 3-Mercapto-2-butanol,mixture of isomers; 3-mercapto-2-butanol, mixture of isomers; 3-mercaptobutan-2-ol; 3-Sulfanylbutan-2-ol |
Formula molecolare |
C4H10OS |
Peso Molecolare |
106.1866 |
InChI |
InChI=1/C4H10OS/c1-3(5)4(2)6/h3-6H,1-2H3 |
Numero CAS |
37887-04-0;54812-86-1 |
EINECS |
253-701-0 |
Struttura molecolare |
|
Densità |
0.993g/cm3 |
Punto di ebollizione |
162.3°C at 760 mmHg |
Indice di rifrazione |
1.472 |
Punto d'infiammabilità |
61.7°C |
|