שם המוצר |
N-(2,6-Diethylphenyl)maleimide |
נרדפות |
1-(2,6-Diethylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione; 1-(2,6-diethylphenyl)-1H-pyrrole-2,5-dione |
מולקולרית פורמולה |
C14H15NO2 |
משקל מולקולרי |
229.2744 |
InChI |
InChI=1/C14H15NO2/c1-3-10-6-5-7-11(4-2)14(10)15-12(16)8-9-13(15)17/h5-9H,3-4H2,1-2H3 |
מספר CAS |
38167-72-5 |
מבנה מולקולרי |
|
צפיפות |
1.17g/cm3 |
נקודת רתיחה |
354.2°C at 760 mmHg |
משקל סגולי |
1.582 |
נקודת הבזק |
151.2°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|