název výrobku |
Cyclohexylphenylacetonitrile |
Synonyma |
alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
Molekulární vzorec |
C14H17N |
Molekulová hmotnost |
199.2915 |
InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
Registrační číslo CAS |
3893-23-0 |
EINECS |
223-442-8 |
Molekulární struktura |
|
Hustota |
1.019g/cm3 |
Bod tání |
49-55℃ |
Bod varu |
322.5°C at 760 mmHg |
Index lomu |
1.54 |
Bod vzplanutí |
156.3°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|