Nama produk |
Ethanone, 1-(5-bromo-3-pyridinyl)- |
Sinonim |
3-Acetyl-5-bromopyridine; 1-(5-bromopyridin-3-yl)ethanone |
MF |
C7H6BrNO |
Berat Molekul |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c1-5(10)6-2-7(8)4-9-3-6/h2-4H,1H3 |
CAS NO |
38940-62-4 |
Struktur Molekul |
|
Kepadatan |
1.534g/cm3 |
Titik didih |
279.321°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
122.729°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|