Naam product |
2-(3-pyridyl)-1,3-thiazole-4-carboxylic acid |
Synoniemen |
2-(pyridin-3-yl)thiazole-4-carboxylic acid; 2-(3-Pyridyl)thiazole-4-carboxylic acid; 2-(pyridin-3-yl)-1,3-thiazole-4-carboxylic acid |
MF |
C9H6N2O2S |
Molecuulgewicht |
206.2211 |
InChI |
InChI=1/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-5H,(H,12,13) |
CAS-nummer |
39067-29-3 |
Moleculaire Structuur |
|
Dichtheid |
1.44g/cm3 |
Smeltpunt |
278℃ |
Kookpunt |
460.3°C at 760 mmHg |
Brekingsindex |
1.651 |
Vlampunt |
232.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|