Naam product |
Chromone-3-carboxylic acid |
Synoniemen |
4-Oxo-4H-1-benzopyran-3-carboxylic acid; 4-oxo-4H-chromene-3-carboxylic acid; 4-oxo-4H-chromene-3-carboxylate |
MF |
C10H5O4 |
Molecuulgewicht |
189.1448 |
InChI |
InChI=1/C10H6O4/c11-9-6-3-1-2-4-8(6)14-5-7(9)10(12)13/h1-5H,(H,12,13)/p-1 |
CAS-nummer |
39079-62-4 |
Moleculaire Structuur |
|
Smeltpunt |
198-200℃ |
Kookpunt |
337°C at 760 mmHg |
Vlampunt |
138.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|