název výrobku |
3,5-Dimethylphenylacetonitrile |
Synonyma |
3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
Molekulární vzorec |
C10H11N |
Molekulová hmotnost |
145.201 |
InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
Registrační číslo CAS |
39101-54-7 |
EINECS |
254-292-1 |
Molekulární struktura |
|
Hustota |
0.979g/cm3 |
Bod varu |
254.5°C at 760 mmHg |
Index lomu |
1.524 |
Bod vzplanutí |
117.5°C |
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|