Nama produk |
3-Methoxyphenylhydrazine hydrochloride |
Sinonim |
3-Methoxyphenylhydrazine HCl; (3-methoxyphenyl)hydrazine; m-Methoxyphenylhydrazine hydrochloride; (3-Methoxy-phenyl)-hydrazine HCl |
MF |
C7H11ClN2O |
Berat Molekul |
174.628 |
InChI |
InChI=1/C7H10N2O.ClH/c1-10-7-4-2-3-6(5-7)9-8;/h2-5,9H,8H2,1H3;1H |
CAS NO |
39232-91-2 |
EINECS |
254-368-4 |
Struktur Molekul |
|
Titik didih |
275.3°C at 760 mmHg |
Titik nyala |
120.3°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|