Naam product |
2-Bromo-5-Fluorobenzoic Acid |
Synoniemen |
2-Bromo-5-fluorobenzoic acid,98%; 2-bromo-5-fluorobenzoicacid,98%; RARECHEM AL BO 0747; BUTTPARK 19\01-66; 2-Bromo-5-Fluorobenzoic; 2-Bromo-5-fluorobenzoic acid 98%; 2-bromo-5-fluorobenzoate |
MF |
C7H3BrFO2 |
Molecuulgewicht |
218.0005 |
InChI |
InChI=1/C7H4BrFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
CAS-nummer |
394-28-5 |
Moleculaire Structuur |
|
Smeltpunt |
154-157℃ |
Kookpunt |
291.1°C at 760 mmHg |
Vlampunt |
129.8°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|