نام محصول |
5-Chloro-2-fluorobenzoyl chloride |
مترادف |
5-Chloro-2-fluorobenzyl chloride; 2-Fluoro-5-Chorobenzoyl Chloride |
میدان مغناطیسی |
C7H3Cl2FO |
وزن مولکولی |
193.0025 |
InChI |
InChI=1/C7H3Cl2FO/c8-4-1-2-6(10)5(3-4)7(9)11/h1-3H |
شماره سیایاس |
394-29-6 |
ساختار مولکولی |
|
تراکم |
1.462g/cm3 |
نقطه غلیان |
213°C at 760 mmHg |
ضریب شکست |
1.539 |
نقطه اشتعال |
82.6°C |
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|