Nazwa produktu: |
ethyl 2,3-dihydroxybenzoate |
Synonimy |
2,3-Dihydroxy-benzoic acid ethyl ester |
MF |
C9H10O4 |
Masie cząsteczkowej |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
Nr CAS |
3943-73-5 |
Struktury molekularnej |
|
Gęstość |
1.294g/cm3 |
Temperatura topnienia |
65℃ |
Temperatura wrzenia |
307.2°C at 760 mmHg |
Współczynnik załamania |
1.573 |
Temperatura zapłonu |
123°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|