product Name |
4,4'-dibromobenzophenone |
Synonyms |
Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
Molecular Formula |
C13H8Br2O |
Molecular Weight |
340.01 |
InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
CAS Registry Number |
3988-03-2 |
EINECS |
223-632-0 |
Molecular Structure |
|
Density |
1.7g/cm3 |
Melting point |
171-174℃ |
Boiling point |
395.6°C at 760 mmHg |
Refractive index |
1.633 |
Flash point |
121°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S22:;
S24/25:;
|
|