Produkt-Name |
Ethyl 3-pyridylacetate |
Synonyme |
Ethyl pyridine-3-acetate; 3-Pyridylacetic acid ethyl ester; LABOTEST-BB LT00847594; 2-(3-pyridyl)-aceticaciethylester; 3-Pyridineacetic acid, ethyl ester; 3-pyridineaceticacid,ethylester; Acetic acid, 2-(3-pyridyl)-, ethyl ester; Ethyl 3-pyridineacetate; Ethyl 3-pyridinylacetate; Ethyl3-pyridylacetate,99%; Ethyl 3-pyridylacetate, GC 99%; ethyl pyridin-3-ylacetate |
Molekulare Formel |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)6-8-4-3-5-10-7-8/h3-5,7H,2,6H2,1H3 |
CAS Registry Number |
39931-77-6 |
EINECS |
254-707-6 |
Molecular Structure |
|
Dichte |
1.086g/cm3 |
Siedepunkt |
274.4°C at 760 mmHg |
Brechungsindex |
1.503 |
Flammpunkt |
105.6°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|