שם המוצר |
1-phenylpiperazine dihydrochloride |
נרדפות |
1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
מולקולרית פורמולה |
C10H16Cl2N2 |
משקל מולקולרי |
235.1534 |
InChI |
InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
מספר CAS |
4004-95-9 |
EINECS |
223-654-0 |
מבנה מולקולרי |
|
נקודת רתיחה |
287.2°C at 760 mmHg |
נקודת הבזק |
138.3°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|