उत्पाद का नाम |
3,5-Dimethylisothiocyanatobenzene |
समानार्थी |
3,5-Dimethylphenyl isothiocyanate; 1-isothiocyanato-3,5-dimethylbenzene |
आणविक फार्मूला |
C9H9NS |
आण्विक वजन |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-7-3-8(2)5-9(4-7)10-6-11/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
40046-30-8 |
आणविक संरचना |
|
घनत्व |
1.01g/cm3 |
उबलने का समय |
282.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.554 |
फ्लैश प्वाइंट |
127.3°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|