product Name |
1-(4-Chlorophenyl)-biguanide hydrochloride |
Synonyms |
1-(4-Chlorophenyl)biguanide hydrochloride; N-(4-chlorophenyl)imidodicarbonimidic diamide; 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine hydrochloride (1:1); N-{(1E)-amino[(diaminomethylidene)ammonio]methylidene}-4-chloroanilinium |
Molecular Formula |
C8H12ClN5 |
Molecular Weight |
213.6663 |
InChI |
InChI=1/C8H10ClN5/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2 |
CAS Registry Number |
4022-81-5 |
EINECS |
226-155-6 |
Molecular Structure |
|
Boiling point |
426.4°C at 760 mmHg |
Flash point |
211.7°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|