product Name |
2-Iodo-3-hydroxypyridine |
Synonyms |
2-Iodo-3-pyridinol; 3-Hydroxy-2-iodopyridine; 2-IODOPYRIDIN-3-OL; 3-Pyridinol, 2-iodo-; Pyridine, 2-iodo-3-hydroxy-; 2-HYDROXY-3-IODOPYRIDINE |
Molecular Formula |
C5H4INO |
Molecular Weight |
220.9958 |
InChI |
InChI=1/C5H4INO/c6-5-4(8)2-1-3-7-5/h1-3,8H |
CAS Registry Number |
40263-57-8 |
EINECS |
254-864-0 |
Molecular Structure |
|
Density |
2.142g/cm3 |
Boiling point |
296.603°C at 760 mmHg |
Refractive index |
1.683 |
Flash point |
133.181°C |
Hazard Symbols |
Xn:;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|