نام محصول |
2-Nitrothiophene-4-carboxylic acid |
مترادف |
5-Nitrothiophene-3-carboxylic acid; 5-nitrothiophene-3-carboxylate |
میدان مغناطیسی |
C5H2NO4S |
وزن مولکولی |
172.1392 |
InChI |
InChI=1/C5H3NO4S/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)/p-1 |
شماره سیایاس |
40357-96-8 |
ساختار مولکولی |
|
نقطه ذوب |
145-146℃ |
نقطه غلیان |
367.2°C at 760 mmHg |
نقطه اشتعال |
175.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|