उत्पाद का नाम |
2,5-Dimethoxyphenyl isothiocyanate |
समानार्थी |
2-isothiocyanato-1,4-dimethoxybenzene |
आणविक फार्मूला |
C9H9NO2S |
आण्विक वजन |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c1-11-7-3-4-9(12-2)8(5-7)10-6-13/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
40532-06-7 |
आणविक संरचना |
|
घनत्व |
1.12g/cm3 |
उबलने का समय |
338.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.537 |
फ्लैश प्वाइंट |
158.3°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|