termék neve |
Dichloroacetic anhydride |
Szinonimák |
Acetic acid, 2,2-dichloro-, 1,1'-anhydride; 4-02-00-00503 (Beilstein Handbook Reference); Anhydrid kyseliny dichloroctove; Anhydrid kyseliny dichloroctove [Czech]; BRN 0512173; Dichloroacetic acid anhydride; NSC 401832; 2,2'-Dichloroacetic anhydride; Acetic acid, dichloro-, anhydride |
MF |
C4H2Cl4O3 |
Molekulatömeg |
239.8689 |
InChI |
InChI=1/C4H2Cl4O3/c5-1(6)3(9)11-4(10)2(7)8/h1-2H |
CAS-szám |
4124-30-5 |
EINECS |
223-924-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.695g/cm3 |
Olvadáspont |
29℃ |
Forráspont |
215°C at 760 mmHg |
Törésmutató |
1.501 |
Gyulladáspont |
90.6°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R21:Harmful in contact with skin.;
R34:Causes burns.;
|
Biztonsági Leírás |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|