نام محصول |
5-Benzoylpentanoic acid |
مترادف |
6-Oxo-6-phenylhexanoic acid |
میدان مغناطیسی |
C12H14O3 |
وزن مولکولی |
206.2378 |
InChI |
InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
شماره سیایاس |
4144-62-1 |
ساختار مولکولی |
|
تراکم |
1.135g/cm3 |
نقطه غلیان |
385.3°C at 760 mmHg |
ضریب شکست |
1.533 |
نقطه اشتعال |
201°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|