produktnavn |
Carbol Fuchsin |
Molekylær Formel |
C21H22ClN3 |
Molekylvekt |
351.8725 |
InChI |
InChI=1/C21H21N3.ClH/c1-13-11-16(5-9-19(13)23)21(15-3-7-18(22)8-4-15)17-6-10-20(24)14(2)12-17;/h3-12,23H,22,24H2,1-2H3;1H/b21-16-,23-19?; |
CAS-nummer |
4197-24-4 |
EINECS |
224-086-6 |
Molecular Structure |
|
Kokepunkt |
573.5°C at 760 mmHg |
Flammepunktet |
300.6°C |
Hazard symboler |
T:Toxic;
|
Risiko Koder |
R24/25:Toxic in contact with skin and if swallowed.;
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|