Ονομασία του προϊόντος |
2-Amino-4-cyanopyridine |
Συνώνυμα |
2-Aminoisonicotinonitrile; 4-Cyano-2-pyridinamine; 2-aminopyridine-4-carbonitrile |
MF |
C6H5N3 |
Μοριακό βάρος |
119.124 |
InChI |
InChI=1/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
CAS ΟΧΙ |
42182-27-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.23g/cm3 |
Σημείο βρασμού |
297.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.594 |
Σημείο ανάφλεξης |
133.8°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|