2,6-Dichloropyridine-4-carbonyl chloride

Название продукта	2,6-Dichloropyridine-4-carbonyl chloride
Синонимы	2,6-Dichloropyridine-4-carboxylic chloride
Молекулярная формула	C₆H₂Cl₃NO
Молекулярный вес	210.4452
InChI	InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H
Регистрационный номер CAS	42521-08-4
Молекулярная структура
Плотность	1.582g/cm³
Точка кипения	280.4°C at 760 mmHg
Показатель преломления	1.582
Температура вспышки	123.4°C
Символы опасности	C:Corrosive;
Риск коды	R34:Causes burns.;
Характеристики безопасности	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;