Название продукта |
2,6-Dichloropyridine-4-carbonyl chloride |
Синонимы |
2,6-Dichloropyridine-4-carboxylic chloride |
Молекулярная формула |
C6H2Cl3NO |
Молекулярный вес |
210.4452 |
InChI |
InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
Регистрационный номер CAS |
42521-08-4 |
Молекулярная структура |
|
Плотность |
1.582g/cm3 |
Точка кипения |
280.4°C at 760 mmHg |
Показатель преломления |
1.582 |
Температура вспышки |
123.4°C |
Символы опасности |
C:Corrosive;
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|