termék neve |
2,3,4-Trimethoxybenzonitrile |
MF |
C10H11NO3 |
Molekulatömeg |
193.1992 |
InChI |
InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
CAS-szám |
43020-38-8 |
EINECS |
256-049-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.15g/cm3 |
Olvadáspont |
55-57℃ |
Forráspont |
311.1°C at 760 mmHg |
Törésmutató |
1.514 |
Gyulladáspont |
127.8°C |
Veszély szimbólumok |
T:Toxic;
|
Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Biztonsági LeÃrás |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|