상품명칭 |
methyl difluoroacetate |
별명 |
Difluoroacetic acid methyl ester; 1,1,2,3,3-pentafluoroprop-1-ene; Methyl 2,2-difluoroacetate |
분자식 |
C3HF5 |
분자량 |
132.0321 |
InChI |
InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
cas번호 |
433-53-4 |
EC번호 |
207-089-7 |
분자 구조 |
|
밀도 |
1.335g/cm3 |
굴절 지수 |
1.264 |
리스크 규칙 |
R11:Highly flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|