Methyl hydrogen phthalate

نام محصول	Methyl hydrogen phthalate
مترادف	Monomethyl phthalate~Phthalic acid monomethyl ester; mono-Methyl phthalate; Phthalic acid monomethyl ester; Benzene-1,2-dicarboxylic acid monomethyl ester~Monomethyl phthalate~Phthalic acid monomethyl ester; 2-(methoxycarbonyl)benzoic acid; 2-(methoxycarbonyl)benzoate
میدان مغناطیسی	C₉H₇O₄
وزن مولکولی	179.15
InChI	InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11)/p-1
شماره سیایاس	4376-18-5
تعداد کمیسیون اروپایی	224-476-6
ساختار مولکولی
نقطه ذوب	81-84℃
نقطه غلیان	328.9°C at 760 mmHg
نقطه اشتعال	134.7°C
کدهای خطر	R36/37/38:Irritating to eyes, respiratory system and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;