اسم المنتج |
1,2,4-Triphenyl-1,4-butanedione |
الاسم المستعار |
1,4-Butanedione, 1,2,4-triphenyl-; AI3-17642; NSC 7759; 1,2,4-triphenylbutane-1,4-dione; (2S)-1,2,4-triphenylbutane-1,4-dione; (2R)-1,2,4-triphenylbutane-1,4-dione |
الصيغة الجزيئية |
C22H18O2 |
الوزن الجزيئي الغرامي |
314.3771 |
InChI |
InChI=1/C22H18O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m1/s1 |
إستراتيجية المساعدة القطرية |
4441-01-4 |
بنية جزيئية |
|
كثافة |
1.143g/cm3 |
نقطة الغليان |
496.2°C at 760 mmHg |
معامل الإنكسار |
1.607 |
نقطة الوميض |
183.6°C |
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|