상품명칭 |
4-Methylnonanoic acid |
별명 |
Nonanoic acid, 4-methyl-; 4-Methylpelargonic acid; AI3-30047; FEMA No. 3574; 4-Methylnonan-1-oic acid; (4R)-4-methylnonanoate; (4S)-4-methylnonanoate |
분자식 |
C10H19O2 |
분자량 |
171.2572 |
InChI |
InChI=1/C10H20O2/c1-3-4-5-6-9(2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)/p-1/t9-/m0/s1 |
cas번호 |
45019-28-1 |
EC번호 |
256-180-8 |
분자 구조 |
|
비등점 |
271.6°C at 760 mmHg |
인화점 |
142.3°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|