produktnavn |
L-Lactide S |
Synonymer |
(3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
Molekylær Formel |
C6H8O4 |
Molekylvekt |
144.1253 |
InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
CAS-nummer |
4511-42-6 |
EINECS |
224-832-0 |
Molecular Structure |
|
Tetthet |
1.186g/cm3 |
Smeltepunkt |
92-98℃ |
Kokepunkt |
285.5°C at 760 mmHg |
Brytningsindeks |
1.429 |
Flammepunktet |
150.6°C |
Risiko Koder |
R36/37:Irritating to eyes and respiratory system.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|