Nazwa produktu: |
2-Mercaptobenzyl alcohol |
Synonimy |
2-(Hydroxymethyl)thiophenol; O-Mercaptobenzyl alcohol; (2-Sulfanylphenyl)methanol; 2- Mercaptobenzyl alcohol, tech.
; 2-(hydroxymethyl)benzenethiolate |
MF |
C7H7OS |
Masie cząsteczkowej |
139.1954 |
InChI |
InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
Nr CAS |
4521-31-7 |
Struktury molekularnej |
|
Temperatura topnienia |
31-32℃ |
Temperatura wrzenia |
276.5°C at 760 mmHg |
Temperatura zapłonu |
121°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|