اسم المنتج |
ethyl pentafluorobenzoate |
الاسم المستعار |
Pentafluorobenzoic acid ethyl ester |
الصيغة الجزيئية |
C9H5F5O2 |
الوزن الجزيئي الغرامي |
240.12
|
InChI |
InChI=1/C9H5F5O2/c1-2-16-9(15)3-4(10)6(12)8(14)7(13)5(3)11/h2H2,1H3 |
إستراتيجية المساعدة القطرية |
4522-93-4 |
المفوضية الأوروبية رقم |
224-854-0 |
بنية جزيئية |
|
كثافة |
1.431 |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|