Nazwa produktu: |
Ethyl phenylcyanoacetate |
Synonimy |
Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
MF |
C11H11NO2 |
Masie cząsteczkowej |
189.2105 |
InChI |
InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
Nr CAS |
4553-07-5 |
EINECS |
224-921-4 |
Struktury molekularnej |
|
Gęstość |
1.117g/cm3 |
Temperatura wrzenia |
275°C at 760 mmHg |
Współczynnik załamania |
1.518 |
Temperatura zapłonu |
137.5°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21:Harmful by inhalation and in contact with skin.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|