Ürün Adı |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride |
Eş anlamlı |
trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
Moleküler Formülü |
C9H8Cl2O2 |
Molekül Ağırlığı |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
CAS kayıt numarası |
4582-21-2 |
EINECS |
224-967-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.453g/cm3 |
Kaynama noktası |
243.334°C at 760 mmHg |
Kırılma indisi |
1.56 |
Alevlenme noktası |
133.454°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|