product Name |
(+/-)-3-phenylbutyric acid |
Synonyms |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
Molecular Formula |
C10H12O2 |
Molecular Weight |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
CAS Registry Number |
4593-90-2 |
EINECS |
224-987-4 |
Molecular Structure |
|
Density |
1.09g/cm3 |
Melting point |
35-38℃ |
Boiling point |
288°C at 760 mmHg |
Refractive index |
1.531 |
Flash point |
170.2°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|