نام محصول |
2-aminothiophene-3-carbonitrile |
مترادف |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
میدان مغناطیسی |
C5H4N2S |
وزن مولکولی |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
شماره سیایاس |
4651-82-5 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه ذوب |
104℃ |
نقطه غلیان |
317.5°C at 760 mmHg |
ضریب شکست |
1.627 |
نقطه اشتعال |
145.8°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|