produktnavn |
3-[2-(3-chlorophenyl)acetyl]benzonitrile |
Synonymer |
3-[(3-chlorophenyl)acetyl]benzonitrile |
Molekylær Formel |
C15H10ClNO |
Molekylvekt |
255.699 |
InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
CAS-nummer |
465514-69-6 |
Molecular Structure |
|
Tetthet |
1.27g/cm3 |
Smeltepunkt |
87.5℃ |
Kokepunkt |
416.5°C at 760 mmHg |
Brytningsindeks |
1.615 |
Flammepunktet |
205.7°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|