termék neve |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate |
MF |
C10H12O4 |
Molekulatömeg |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
CAS-szám |
4707-47-5 |
EINECS |
225-193-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.251g/cm3 |
Forráspont |
360.7°C at 760 mmHg |
Törésmutató |
1.57 |
Gyulladáspont |
143.9°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|