اسم المنتج |
Tri-n-octylphosphine |
الاسم المستعار |
Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
الصيغة الجزيئية |
C24H51P |
الوزن الجزيئي الغرامي |
370.6355 |
InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
إستراتيجية المساعدة القطرية |
4731-53-7 |
المفوضية الأوروبية رقم |
225-234-2 |
بنية جزيئية |
|
نقطة الغليان |
445°C at 760 mmHg |
نقطة الوميض |
236°C |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|