상품명칭 |
Tris-(2-methoxyphenyl)-phosphine |
별명 |
Tris(2-methoxyphenyl)phosphine; Tri(o-anisyl)phosphine; tris(2-methoxyphenyl)phosphane; Tris(o-methoxyphenyl)phosphine |
분자식 |
C21H21O3P |
분자량 |
352.3634 |
InChI |
InChI=1/C21H21O3P/c1-22-16-10-4-7-13-19(16)25(20-14-8-5-11-17(20)23-2)21-15-9-6-12-18(21)24-3/h4-15H,1-3H3 |
cas번호 |
4731-65-1 |
EC번호 |
225-235-8 |
분자 구조 |
|
비등점 |
477.3°C at 760 mmHg |
인화점 |
302.5°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|